C13H12N2O3 — CID 172914397
4-[(2-aminophenyl)iminomethyl]benzene-1,2,3-triol (PubChem CID 172914397) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 4-[(2-aminophenyl)iminomethyl]benzene-1,2,3-triol.
| Compound Name | 4-[(2-aminophenyl)iminomethyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 172914397 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 4-[(2-aminophenyl)iminomethyl]benzene-1,2,3-triol |
| SMILES | Nc1ccccc1/N=C/c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C13H12N2O3/c14-9-3-1-2-4-10(9)15-7-8-5-6-11(16)13(18)12(8)17/h1-7,16-18H,14H2/b15-7+ |
| InChIKey | VDOHBZQWBZCXBW-VIZOYTHASA-N |
| XLogP | 2.14 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|