C31H26I2N2O — CID 137090191
2-[[(4R,10R)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]iminomethyl]-4,6-diiodophenol (PubChem CID 137090191) has the molecular formula C31H26I2N2O and a molecular weight of 696.37 g/mol. Its IUPAC name is 2-[[(4R,10R)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]iminomethyl]-4,6-diiodophenol.
| Compound Name | 2-[[(4R,10R)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]iminomethyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 137090191 |
| Molecular Formula | C31H26I2N2O |
| Molecular Weight | 696.37 g/mol |
| Exact Mass | 696.01 |
| IUPAC Name | 2-[[(4R,10R)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]iminomethyl]-4,6-diiodophenol |
| SMILES | Oc1c(I)cc(I)cc1/C=N/c1cc2c3c(c1)[C@@H](c1ccccc1)CCN3CC[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C31H26I2N2O/c32-23-15-22(31(36)29(33)16-23)19-34-24-17-27-25(20-7-3-1-4-8-20)11-13-35-14-12-26(28(18-24)30(27)35)21-9-5-2-6-10-21/h1-10,15-19,25-26,36H,11-14H2/b34-19+/t25-,26-/m1/s1 |
| InChIKey | PIORHMFYKNBUEE-UTVAHVDMSA-N |
| XLogP | 8.23 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.37 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|