C13H4F5I2NO — CID 136744615
2,4-diiodo-6-[(2,3,4,5,6-pentafluorophenyl)iminomethyl]phenol (PubChem CID 136744615) has the molecular formula C13H4F5I2NO and a molecular weight of 538.98 g/mol. Its IUPAC name is 2,4-diiodo-6-[(2,3,4,5,6-pentafluorophenyl)iminomethyl]phenol.
| Compound Name | 2,4-diiodo-6-[(2,3,4,5,6-pentafluorophenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 136744615 |
| Molecular Formula | C13H4F5I2NO |
| Molecular Weight | 538.98 g/mol |
| Exact Mass | 538.83 |
| IUPAC Name | 2,4-diiodo-6-[(2,3,4,5,6-pentafluorophenyl)iminomethyl]phenol |
| SMILES | Oc1c(I)cc(I)cc1/C=N/c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H4F5I2NO/c14-7-8(15)10(17)12(11(18)9(7)16)21-3-4-1-5(19)2-6(20)13(4)22/h1-3,22H/b21-3+ |
| InChIKey | VDYQMLWYSDMDOX-WSVFEZOKSA-N |
| XLogP | 5.05 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.98 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|