C9H6I2N4O2 — CID 5059865
2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethyl]-4,6-diiodophenol (PubChem CID 5059865) has the molecular formula C9H6I2N4O2 and a molecular weight of 455.98 g/mol. Its IUPAC name is 2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethyl]-4,6-diiodophenol.
| Compound Name | 2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 5059865 |
| Molecular Formula | C9H6I2N4O2 |
| Molecular Weight | 455.98 g/mol |
| Exact Mass | 455.86 |
| IUPAC Name | 2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethyl]-4,6-diiodophenol |
| SMILES | Nc1nonc1/N=C/c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C9H6I2N4O2/c10-5-1-4(7(16)6(11)2-5)3-13-9-8(12)14-17-15-9/h1-3,16H,(H2,12,14)/b13-3+ |
| InChIKey | QOUJRNMCOAYZBG-QLKAYGNNSA-N |
| XLogP | 2.32 |
| TPSA | 97.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.98 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|