C20H11FI2N2O2 — CID 3096685
2-[[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4,6-diiodophenol (PubChem CID 3096685) has the molecular formula C20H11FI2N2O2 and a molecular weight of 584.13 g/mol. Its IUPAC name is 2-[[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4,6-diiodophenol.
| Compound Name | 2-[[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 3096685 |
| Molecular Formula | C20H11FI2N2O2 |
| Molecular Weight | 584.13 g/mol |
| Exact Mass | 583.89 |
| IUPAC Name | 2-[[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4,6-diiodophenol |
| SMILES | Oc1c(I)cc(I)cc1/C=N/c1ccc2oc(-c3ccc(F)cc3)nc2c1 |
| InChI | InChI=1S/C20H11FI2N2O2/c21-13-3-1-11(2-4-13)20-25-17-9-15(5-6-18(17)27-20)24-10-12-7-14(22)8-16(23)19(12)26/h1-10,26H/b24-10+ |
| InChIKey | QHMWWJMBWRQDRN-YSURURNPSA-N |
| XLogP | 6.30 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.13 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|