C13H8FNO2 — CID 3625866
2-(4-fluorophenyl)-1,3-benzoxazol-5-ol (PubChem CID 3625866) has the molecular formula C13H8FNO2 and a molecular weight of 229.21 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1,3-benzoxazol-5-ol.
| Compound Name | 2-(4-fluorophenyl)-1,3-benzoxazol-5-ol |
|---|---|
| PubChem CID | 3625866 |
| Molecular Formula | C13H8FNO2 |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 2-(4-fluorophenyl)-1,3-benzoxazol-5-ol |
| SMILES | Oc1ccc2oc(-c3ccc(F)cc3)nc2c1 |
| InChI | InChI=1S/C13H8FNO2/c14-9-3-1-8(2-4-9)13-15-11-7-10(16)5-6-12(11)17-13/h1-7,16H |
| InChIKey | DDAPYFMDZYRZOW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |