C16H16FNO3 — CID 175273673
acetic acid;2-(4-fluorophenyl)-1,3-benzoxazole;methane (PubChem CID 175273673) has the molecular formula C16H16FNO3 and a molecular weight of 289.31 g/mol. Its IUPAC name is acetic acid;2-(4-fluorophenyl)-1,3-benzoxazole;methane.
| Compound Name | acetic acid;2-(4-fluorophenyl)-1,3-benzoxazole;methane |
|---|---|
| PubChem CID | 175273673 |
| Molecular Formula | C16H16FNO3 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | acetic acid;2-(4-fluorophenyl)-1,3-benzoxazole;methane |
| SMILES | C.CC(=O)O.Fc1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C13H8FNO.C2H4O2.CH4/c14-10-7-5-9(6-8-10)13-15-11-3-1-2-4-12(11)16-13;1-2(3)4;/h1-8H;1H3,(H,3,4);1H4 |
| InChIKey | SZYPJDRWXUOYSI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |