C19H14FN2O+ — CID 91680069
2-[1-[(4-fluorophenyl)methyl]pyridin-1-ium-4-yl]-1,3-benzoxazole (PubChem CID 91680069) has the molecular formula C19H14FN2O+ and a molecular weight of 305.33 g/mol. Its IUPAC name is 2-[1-[(4-fluorophenyl)methyl]pyridin-1-ium-4-yl]-1,3-benzoxazole.
| Compound Name | 2-[1-[(4-fluorophenyl)methyl]pyridin-1-ium-4-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 91680069 |
| Molecular Formula | C19H14FN2O+ |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 2-[1-[(4-fluorophenyl)methyl]pyridin-1-ium-4-yl]-1,3-benzoxazole |
| SMILES | Fc1ccc(C[n+]2ccc(-c3nc4ccccc4o3)cc2)cc1 |
| InChI | InChI=1S/C19H14FN2O/c20-16-7-5-14(6-8-16)13-22-11-9-15(10-12-22)19-21-17-3-1-2-4-18(17)23-19/h1-12H,13H2/q+1 |
| InChIKey | ZGGZCKNHQDMIDF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|