C18H13N2O+ — CID 164517941
2-(1-phenylpyridin-1-ium-4-yl)-1,3-benzoxazole (PubChem CID 164517941) has the molecular formula C18H13N2O+ and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-(1-phenylpyridin-1-ium-4-yl)-1,3-benzoxazole.
| Compound Name | 2-(1-phenylpyridin-1-ium-4-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 164517941 |
| Molecular Formula | C18H13N2O+ |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-(1-phenylpyridin-1-ium-4-yl)-1,3-benzoxazole |
| SMILES | c1ccc(-[n+]2ccc(-c3nc4ccccc4o3)cc2)cc1 |
| InChI | InChI=1S/C18H13N2O/c1-2-6-15(7-3-1)20-12-10-14(11-13-20)18-19-16-8-4-5-9-17(16)21-18/h1-13H/q+1 |
| InChIKey | UNAQCNJVAAGWPP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|