C21H15FN2O2 — CID 2994943
N-[[4-(1,3-benzoxazol-2-yl)phenyl]methyl]-2-fluorobenzamide (PubChem CID 2994943) has the molecular formula C21H15FN2O2 and a molecular weight of 346.36 g/mol. Its IUPAC name is N-[[4-(1,3-benzoxazol-2-yl)phenyl]methyl]-2-fluorobenzamide.
| Compound Name | N-[[4-(1,3-benzoxazol-2-yl)phenyl]methyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 2994943 |
| Molecular Formula | C21H15FN2O2 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-[[4-(1,3-benzoxazol-2-yl)phenyl]methyl]-2-fluorobenzamide |
| SMILES | O=C(NCc1ccc(-c2nc3ccccc3o2)cc1)c1ccccc1F |
| InChI | InChI=1S/C21H15FN2O2/c22-17-6-2-1-5-16(17)20(25)23-13-14-9-11-15(12-10-14)21-24-18-7-3-4-8-19(18)26-21/h1-12H,13H2,(H,23,25) |
| InChIKey | XKUKGHVXTYMIMW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |