C22H15ClIN3O2S — CID 17316424
N-[[4-(1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]-2-chloro-5-iodobenzamide (PubChem CID 17316424) has the molecular formula C22H15ClIN3O2S and a molecular weight of 547.81 g/mol. Its IUPAC name is N-[[4-(1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]-2-chloro-5-iodobenzamide.
| Compound Name | N-[[4-(1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]-2-chloro-5-iodobenzamide |
|---|---|
| PubChem CID | 17316424 |
| Molecular Formula | C22H15ClIN3O2S |
| Molecular Weight | 547.81 g/mol |
| Exact Mass | 546.96 |
| IUPAC Name | N-[[4-(1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]-2-chloro-5-iodobenzamide |
| SMILES | O=C(NC(=S)NCc1ccc(-c2nc3ccccc3o2)cc1)c1cc(I)ccc1Cl |
| InChI | InChI=1S/C22H15ClIN3O2S/c23-17-10-9-15(24)11-16(17)20(28)27-22(30)25-12-13-5-7-14(8-6-13)21-26-18-3-1-2-4-19(18)29-21/h1-11H,12H2,(H2,25,27,28,30) |
| InChIKey | HUAWYUKBGUEKNA-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.81 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|