C20H13ClIN3O2 — CID 17336639
2-chloro-5-iodo-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]methyl]benzamide (PubChem CID 17336639) has the molecular formula C20H13ClIN3O2 and a molecular weight of 489.70 g/mol. Its IUPAC name is 2-chloro-5-iodo-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]methyl]benzamide.
| Compound Name | 2-chloro-5-iodo-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 17336639 |
| Molecular Formula | C20H13ClIN3O2 |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 488.97 |
| IUPAC Name | 2-chloro-5-iodo-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(-c2nc3ncccc3o2)cc1)c1cc(I)ccc1Cl |
| InChI | InChI=1S/C20H13ClIN3O2/c21-16-8-7-14(22)10-15(16)19(26)24-11-12-3-5-13(6-4-12)20-25-18-17(27-20)2-1-9-23-18/h1-10H,11H2,(H,24,26) |
| InChIKey | IAIXRCASZYNOLT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|