C21H13F4N3O3 — CID 17336686
2,3,5,6-tetrafluoro-4-methoxy-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]methyl]benzamide (PubChem CID 17336686) has the molecular formula C21H13F4N3O3 and a molecular weight of 431.35 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-methoxy-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]methyl]benzamide.
| Compound Name | 2,3,5,6-tetrafluoro-4-methoxy-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 17336686 |
| Molecular Formula | C21H13F4N3O3 |
| Molecular Weight | 431.35 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-methoxy-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]methyl]benzamide |
| SMILES | COc1c(F)c(F)c(C(=O)NCc2ccc(-c3nc4ncccc4o3)cc2)c(F)c1F |
| InChI | InChI=1S/C21H13F4N3O3/c1-30-18-16(24)14(22)13(15(23)17(18)25)20(29)27-9-10-4-6-11(7-5-10)21-28-19-12(31-21)3-2-8-26-19/h2-8H,9H2,1H3,(H,27,29) |
| InChIKey | LOFBTVKOERGSTJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.35 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|