C25H24N4O3S — CID 17336401
3-butoxy-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]methylcarbamothioyl]benzamide (PubChem CID 17336401) has the molecular formula C25H24N4O3S and a molecular weight of 460.56 g/mol. Its IUPAC name is 3-butoxy-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]methylcarbamothioyl]benzamide.
| Compound Name | 3-butoxy-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]methylcarbamothioyl]benzamide |
|---|---|
| PubChem CID | 17336401 |
| Molecular Formula | C25H24N4O3S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 3-butoxy-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]methylcarbamothioyl]benzamide |
| SMILES | CCCCOc1cccc(C(=O)NC(=S)NCc2ccc(-c3nc4ncccc4o3)cc2)c1 |
| InChI | InChI=1S/C25H24N4O3S/c1-2-3-14-31-20-7-4-6-19(15-20)23(30)29-25(33)27-16-17-9-11-18(12-10-17)24-28-22-21(32-24)8-5-13-26-22/h4-13,15H,2-3,14,16H2,1H3,(H2,27,29,30,33) |
| InChIKey | IAGJFOQBMPAIAD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|