C22H17BrN4O3S — CID 17336385
3-bromo-4-methoxy-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]methylcarbamothioyl]benzamide (PubChem CID 17336385) has the molecular formula C22H17BrN4O3S and a molecular weight of 497.37 g/mol. Its IUPAC name is 3-bromo-4-methoxy-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]methylcarbamothioyl]benzamide.
| Compound Name | 3-bromo-4-methoxy-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]methylcarbamothioyl]benzamide |
|---|---|
| PubChem CID | 17336385 |
| Molecular Formula | C22H17BrN4O3S |
| Molecular Weight | 497.37 g/mol |
| Exact Mass | 496.02 |
| IUPAC Name | 3-bromo-4-methoxy-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]methylcarbamothioyl]benzamide |
| SMILES | COc1ccc(C(=O)NC(=S)NCc2ccc(-c3nc4ncccc4o3)cc2)cc1Br |
| InChI | InChI=1S/C22H17BrN4O3S/c1-29-17-9-8-15(11-16(17)23)20(28)27-22(31)25-12-13-4-6-14(7-5-13)21-26-19-18(30-21)3-2-10-24-19/h2-11H,12H2,1H3,(H2,25,27,28,31) |
| InChIKey | JKJZYUDLQNUOFH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|