C24H20BrN3O3S — CID 17114925
N-[[4-(1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]-5-bromo-2-methoxy-3-methylbenzamide (PubChem CID 17114925) has the molecular formula C24H20BrN3O3S and a molecular weight of 510.41 g/mol. Its IUPAC name is N-[[4-(1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]-5-bromo-2-methoxy-3-methylbenzamide.
| Compound Name | N-[[4-(1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]-5-bromo-2-methoxy-3-methylbenzamide |
|---|---|
| PubChem CID | 17114925 |
| Molecular Formula | C24H20BrN3O3S |
| Molecular Weight | 510.41 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | N-[[4-(1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]-5-bromo-2-methoxy-3-methylbenzamide |
| SMILES | COc1c(C)cc(Br)cc1C(=O)NC(=S)NCc1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C24H20BrN3O3S/c1-14-11-17(25)12-18(21(14)30-2)22(29)28-24(32)26-13-15-7-9-16(10-8-15)23-27-19-5-3-4-6-20(19)31-23/h3-12H,13H2,1-2H3,(H2,26,28,29,32) |
| InChIKey | FRMOCAYXLPJKOP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.41 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|