C30H20N2O4 — CID 17110634
N-[[4-(1,3-benzoxazol-2-yl)phenyl]methyl]-4-(2-oxochromen-3-yl)benzamide (PubChem CID 17110634) has the molecular formula C30H20N2O4 and a molecular weight of 472.50 g/mol. Its IUPAC name is N-[[4-(1,3-benzoxazol-2-yl)phenyl]methyl]-4-(2-oxochromen-3-yl)benzamide.
| Compound Name | N-[[4-(1,3-benzoxazol-2-yl)phenyl]methyl]-4-(2-oxochromen-3-yl)benzamide |
|---|---|
| PubChem CID | 17110634 |
| Molecular Formula | C30H20N2O4 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | N-[[4-(1,3-benzoxazol-2-yl)phenyl]methyl]-4-(2-oxochromen-3-yl)benzamide |
| SMILES | O=C(NCc1ccc(-c2nc3ccccc3o2)cc1)c1ccc(-c2cc3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C30H20N2O4/c33-28(21-15-13-20(14-16-21)24-17-23-5-1-3-7-26(23)36-30(24)34)31-18-19-9-11-22(12-10-19)29-32-25-6-2-4-8-27(25)35-29/h1-17H,18H2,(H,31,33) |
| InChIKey | UEFOSWFFGYFTRM-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|