C20H15NO3 — CID 118228942
2-[4-(2-methoxyphenyl)phenyl]-1,3-benzoxazol-5-ol (PubChem CID 118228942) has the molecular formula C20H15NO3 and a molecular weight of 317.34 g/mol. Its IUPAC name is 2-[4-(2-methoxyphenyl)phenyl]-1,3-benzoxazol-5-ol.
| Compound Name | 2-[4-(2-methoxyphenyl)phenyl]-1,3-benzoxazol-5-ol |
|---|---|
| PubChem CID | 118228942 |
| Molecular Formula | C20H15NO3 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 2-[4-(2-methoxyphenyl)phenyl]-1,3-benzoxazol-5-ol |
| SMILES | COc1ccccc1-c1ccc(-c2nc3cc(O)ccc3o2)cc1 |
| InChI | InChI=1S/C20H15NO3/c1-23-18-5-3-2-4-16(18)13-6-8-14(9-7-13)20-21-17-12-15(22)10-11-19(17)24-20/h2-12,22H,1H3 |
| InChIKey | NGSIZBOJZUPVSU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |