C34H20I4N2O2 — CID 136912130
2-[[1-[2-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]naphthalen-1-yl]naphthalen-2-yl]iminomethyl]-4,6-diiodophenol (PubChem CID 136912130) has the molecular formula C34H20I4N2O2 and a molecular weight of 996.16 g/mol. Its IUPAC name is 2-[[1-[2-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]naphthalen-1-yl]naphthalen-2-yl]iminomethyl]-4,6-diiodophenol.
| Compound Name | 2-[[1-[2-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]naphthalen-1-yl]naphthalen-2-yl]iminomethyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 136912130 |
| Molecular Formula | C34H20I4N2O2 |
| Molecular Weight | 996.16 g/mol |
| Exact Mass | 995.77 |
| IUPAC Name | 2-[[1-[2-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]naphthalen-1-yl]naphthalen-2-yl]iminomethyl]-4,6-diiodophenol |
| SMILES | Oc1c(I)cc(I)cc1/C=N/c1ccc2ccccc2c1-c1c(/N=C/c2cc(I)cc(I)c2O)ccc2ccccc12 |
| InChI | InChI=1S/C34H20I4N2O2/c35-23-13-21(33(41)27(37)15-23)17-39-29-11-9-19-5-1-3-7-25(19)31(29)32-26-8-4-2-6-20(26)10-12-30(32)40-18-22-14-24(36)16-28(38)34(22)42/h1-18,41-42H/b39-17+,40-18+ |
| InChIKey | QVJCMYFTKGKHSN-KHYZFUKWSA-N |
| XLogP | 10.99 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 996.16 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|