C40H28N4O4U — CID 139115041
bis(2-[[2-[(2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate);uranium(4+) (PubChem CID 139115041) has the molecular formula C40H28N4O4U and a molecular weight of 866.72 g/mol. Its IUPAC name is bis(2-[[2-[(2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate);uranium(4+).
| Compound Name | bis(2-[[2-[(2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate);uranium(4+) |
|---|---|
| PubChem CID | 139115041 |
| Molecular Formula | C40H28N4O4U |
| Molecular Weight | 866.72 g/mol |
| Exact Mass | 866.26 |
| IUPAC Name | bis(2-[[2-[(2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate);uranium(4+) |
| SMILES | [O-]c1ccccc1/C=N/c1ccccc1/N=C/c1ccccc1[O-].[O-]c1ccccc1C=Nc1ccccc1N=Cc1ccccc1[O-].[U+4] |
| InChI | InChI=1S/2C20H16N2O2.U/c2*23-19-11-5-1-7-15(19)13-21-17-9-3-4-10-18(17)22-14-16-8-2-6-12-20(16)24;/h2*1-14,23-24H;/q;;+4/p-4/b21-13+,22-14+;; |
| InChIKey | OWOJMFUKITTYFW-FDOBHKDXSA-J |
| XLogP | 6.67 |
| TPSA | 141.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.72 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|