C20H12F2N2O2Pt — CID 86298558
4-fluoro-2-[[2-[(5-fluoro-2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate;platinum(2+) (PubChem CID 86298558) has the molecular formula C20H12F2N2O2Pt and a molecular weight of 545.40 g/mol. Its IUPAC name is 4-fluoro-2-[[2-[(5-fluoro-2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate;platinum(2+).
| Compound Name | 4-fluoro-2-[[2-[(5-fluoro-2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate;platinum(2+) |
|---|---|
| PubChem CID | 86298558 |
| Molecular Formula | C20H12F2N2O2Pt |
| Molecular Weight | 545.40 g/mol |
| Exact Mass | 545.05 |
| IUPAC Name | 4-fluoro-2-[[2-[(5-fluoro-2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate;platinum(2+) |
| SMILES | [O-]c1ccc(F)cc1/C=N/c1ccccc1/N=C/c1cc(F)ccc1[O-].[Pt+2] |
| InChI | InChI=1S/C20H14F2N2O2.Pt/c21-15-5-7-19(25)13(9-15)11-23-17-3-1-2-4-18(17)24-12-14-10-16(22)6-8-20(14)26;/h1-12,25-26H;/q;+2/p-2/b23-11+,24-12+; |
| InChIKey | FQIZJFQKZLYNNV-HGBIREINSA-L |
| XLogP | 3.61 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|