C13H9F2N — CID 23340889
1-(2,5-difluorophenyl)-N-phenylmethanimine (PubChem CID 23340889) has the molecular formula C13H9F2N and a molecular weight of 217.22 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-N-phenylmethanimine.
| Compound Name | 1-(2,5-difluorophenyl)-N-phenylmethanimine |
|---|---|
| PubChem CID | 23340889 |
| Molecular Formula | C13H9F2N |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 1-(2,5-difluorophenyl)-N-phenylmethanimine |
| SMILES | Fc1ccc(F)c(/C=N/c2ccccc2)c1 |
| InChI | InChI=1S/C13H9F2N/c14-11-6-7-13(15)10(8-11)9-16-12-4-2-1-3-5-12/h1-9H/b16-9+ |
| InChIKey | HUPDCNNPTBNBBI-CXUHLZMHSA-N |
| XLogP | 3.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|