C7H4F2S — CID 91234855
2,5-difluorothiobenzaldehyde (PubChem CID 91234855) has the molecular formula C7H4F2S and a molecular weight of 158.17 g/mol. Its IUPAC name is 2,5-difluorothiobenzaldehyde.
| Compound Name | 2,5-difluorothiobenzaldehyde |
|---|---|
| PubChem CID | 91234855 |
| Molecular Formula | C7H4F2S |
| Molecular Weight | 158.17 g/mol |
| Exact Mass | 158.00 |
| IUPAC Name | 2,5-difluorothiobenzaldehyde |
| SMILES | Fc1ccc(F)c(C=S)c1 |
| InChI | InChI=1S/C7H4F2S/c8-6-1-2-7(9)5(3-6)4-10/h1-4H |
| InChIKey | AXQOMPUVMPQTNY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.17 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|