C10H10F2 — CID 58787158
2-[(E)-but-1-enyl]-1,4-difluorobenzene (PubChem CID 58787158) has the molecular formula C10H10F2 and a molecular weight of 168.19 g/mol. Its IUPAC name is 2-[(E)-but-1-enyl]-1,4-difluorobenzene.
| Compound Name | 2-[(E)-but-1-enyl]-1,4-difluorobenzene |
|---|---|
| PubChem CID | 58787158 |
| Molecular Formula | C10H10F2 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 2-[(E)-but-1-enyl]-1,4-difluorobenzene |
| SMILES | CC/C=C/c1cc(F)ccc1F |
| InChI | InChI=1S/C10H10F2/c1-2-3-4-8-7-9(11)5-6-10(8)12/h3-7H,2H2,1H3/b4-3+ |
| InChIKey | YMMQWSLYKNUATH-ONEGZZNKSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |