C11H13F2N — CID 79590280
4-(2,5-difluorophenyl)-N-methylbut-3-en-1-amine (PubChem CID 79590280) has the molecular formula C11H13F2N and a molecular weight of 197.23 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N-methylbut-3-en-1-amine.
| Compound Name | 4-(2,5-difluorophenyl)-N-methylbut-3-en-1-amine |
|---|---|
| PubChem CID | 79590280 |
| Molecular Formula | C11H13F2N |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N-methylbut-3-en-1-amine |
| SMILES | CNCCC=Cc1cc(F)ccc1F |
| InChI | InChI=1S/C11H13F2N/c1-14-7-3-2-4-9-8-10(12)5-6-11(9)13/h2,4-6,8,14H,3,7H2,1H3 |
| InChIKey | BSRRGXMTWVQHRL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|