C12H15F2N — CID 79593591
5-(2,5-difluorophenyl)-N-methylpent-3-en-1-amine (PubChem CID 79593591) has the molecular formula C12H15F2N and a molecular weight of 211.26 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)-N-methylpent-3-en-1-amine.
| Compound Name | 5-(2,5-difluorophenyl)-N-methylpent-3-en-1-amine |
|---|---|
| PubChem CID | 79593591 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 5-(2,5-difluorophenyl)-N-methylpent-3-en-1-amine |
| SMILES | CNCCC=CCc1cc(F)ccc1F |
| InChI | InChI=1S/C12H15F2N/c1-15-8-4-2-3-5-10-9-11(13)6-7-12(10)14/h2-3,6-7,9,15H,4-5,8H2,1H3 |
| InChIKey | MIYMRKGRGOCZNF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|