C14H19BrFN — CID 79591063
5-(2-bromo-5-fluorophenyl)-N-propylpent-3-en-1-amine (PubChem CID 79591063) has the molecular formula C14H19BrFN and a molecular weight of 300.21 g/mol. Its IUPAC name is 5-(2-bromo-5-fluorophenyl)-N-propylpent-3-en-1-amine.
| Compound Name | 5-(2-bromo-5-fluorophenyl)-N-propylpent-3-en-1-amine |
|---|---|
| PubChem CID | 79591063 |
| Molecular Formula | C14H19BrFN |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 5-(2-bromo-5-fluorophenyl)-N-propylpent-3-en-1-amine |
| SMILES | CCCNCCC=CCc1cc(F)ccc1Br |
| InChI | InChI=1S/C14H19BrFN/c1-2-9-17-10-5-3-4-6-12-11-13(16)7-8-14(12)15/h3-4,7-8,11,17H,2,5-6,9-10H2,1H3 |
| InChIKey | GSLYHBWETXNXQM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|