C14H19BrFNO — CID 79598285
5-(2-bromo-4-fluorophenyl)-N-(2-methoxyethyl)pent-3-en-1-amine (PubChem CID 79598285) has the molecular formula C14H19BrFNO and a molecular weight of 316.21 g/mol. Its IUPAC name is 5-(2-bromo-4-fluorophenyl)-N-(2-methoxyethyl)pent-3-en-1-amine.
| Compound Name | 5-(2-bromo-4-fluorophenyl)-N-(2-methoxyethyl)pent-3-en-1-amine |
|---|---|
| PubChem CID | 79598285 |
| Molecular Formula | C14H19BrFNO |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 5-(2-bromo-4-fluorophenyl)-N-(2-methoxyethyl)pent-3-en-1-amine |
| SMILES | COCCNCCC=CCc1ccc(F)cc1Br |
| InChI | InChI=1S/C14H19BrFNO/c1-18-10-9-17-8-4-2-3-5-12-6-7-13(16)11-14(12)15/h2-3,6-7,11,17H,4-5,8-10H2,1H3 |
| InChIKey | LKNHMENZAWFJJW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|