C14H19F2N — CID 114935075
(E)-5-(2,6-difluorophenyl)-N-propylpent-3-en-1-amine (PubChem CID 114935075) has the molecular formula C14H19F2N and a molecular weight of 239.31 g/mol. Its IUPAC name is (E)-5-(2,6-difluorophenyl)-N-propylpent-3-en-1-amine.
| Compound Name | (E)-5-(2,6-difluorophenyl)-N-propylpent-3-en-1-amine |
|---|---|
| PubChem CID | 114935075 |
| Molecular Formula | C14H19F2N |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (E)-5-(2,6-difluorophenyl)-N-propylpent-3-en-1-amine |
| SMILES | CCCNCC/C=C/Cc1c(F)cccc1F |
| InChI | InChI=1S/C14H19F2N/c1-2-10-17-11-5-3-4-7-12-13(15)8-6-9-14(12)16/h3-4,6,8-9,17H,2,5,7,10-11H2,1H3/b4-3+ |
| InChIKey | GDIVJXCSHDBWAM-ONEGZZNKSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|