C13H19BrN2 — CID 104813629
(E)-5-(5-bromo-2-pyridinyl)-N-propylpent-3-en-1-amine (PubChem CID 104813629) has the molecular formula C13H19BrN2 and a molecular weight of 283.21 g/mol. Its IUPAC name is (E)-5-(5-bromo-2-pyridinyl)-N-propylpent-3-en-1-amine.
| Compound Name | (E)-5-(5-bromo-2-pyridinyl)-N-propylpent-3-en-1-amine |
|---|---|
| PubChem CID | 104813629 |
| Molecular Formula | C13H19BrN2 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | (E)-5-(5-bromo-2-pyridinyl)-N-propylpent-3-en-1-amine |
| SMILES | CCCNCC/C=C/Cc1ccc(Br)cn1 |
| InChI | InChI=1S/C13H19BrN2/c1-2-9-15-10-5-3-4-6-13-8-7-12(14)11-16-13/h3-4,7-8,11,15H,2,5-6,9-10H2,1H3/b4-3+ |
| InChIKey | RDXSFQDEVRPMCB-ONEGZZNKSA-N |
| XLogP | 3.33 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|