C15H25BrN2 — CID 104810948
2-[(5-bromo-2-pyridinyl)methyl]-2,3-dimethyl-N-propylbutan-1-amine (PubChem CID 104810948) has the molecular formula C15H25BrN2 and a molecular weight of 313.28 g/mol. Its IUPAC name is 2-[(5-bromo-2-pyridinyl)methyl]-2,3-dimethyl-N-propylbutan-1-amine.
| Compound Name | 2-[(5-bromo-2-pyridinyl)methyl]-2,3-dimethyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 104810948 |
| Molecular Formula | C15H25BrN2 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2-[(5-bromo-2-pyridinyl)methyl]-2,3-dimethyl-N-propylbutan-1-amine |
| SMILES | CCCNCC(C)(Cc1ccc(Br)cn1)C(C)C |
| InChI | InChI=1S/C15H25BrN2/c1-5-8-17-11-15(4,12(2)3)9-14-7-6-13(16)10-18-14/h6-7,10,12,17H,5,8-9,11H2,1-4H3 |
| InChIKey | IRIIDUUMDALXLR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|