C18H31N — CID 83160491
2-[(2,5-dimethylphenyl)methyl]-2,3-dimethyl-N-propylbutan-1-amine (PubChem CID 83160491) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)methyl]-2,3-dimethyl-N-propylbutan-1-amine.
| Compound Name | 2-[(2,5-dimethylphenyl)methyl]-2,3-dimethyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 83160491 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 2-[(2,5-dimethylphenyl)methyl]-2,3-dimethyl-N-propylbutan-1-amine |
| SMILES | CCCNCC(C)(Cc1cc(C)ccc1C)C(C)C |
| InChI | InChI=1S/C18H31N/c1-7-10-19-13-18(6,14(2)3)12-17-11-15(4)8-9-16(17)5/h8-9,11,14,19H,7,10,12-13H2,1-6H3 |
| InChIKey | RTPYJNHUMZJUFA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|