About 2,3-dimethyl-N-propyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine
2,3-dimethyl-N-propyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine (PubChem CID 83160211) has the molecular formula C13H24N2S
and a molecular weight of 240.42 g/mol. Its IUPAC name is 2,3-dimethyl-N-propyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine.
Molecular Properties
| Compound Name | 2,3-dimethyl-N-propyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine |
| PubChem CID | 83160211 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 2,3-dimethyl-N-propyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine |
| SMILES | CCCNCC(C)(Cc1nccs1)C(C)C |
| InChI | InChI=1S/C13H24N2S/c1-5-6-14-10-13(4,11(2)3)9-12-15-7-8-16-12/h7-8,11,14H,5-6,9-10H2,1-4H3 |
| InChIKey | UNWLHWFIWWBVEE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-N-propyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-N-propyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine?
The IUPAC name of 2,3-dimethyl-N-propyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine (CID 83160211) is 2,3-dimethyl-N-propyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine.
What is the SMILES notation for 2,3-dimethyl-N-propyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine?
The canonical SMILES for 2,3-dimethyl-N-propyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine is CCCNCC(C)(Cc1nccs1)C(C)C.
What is the InChIKey of 2,3-dimethyl-N-propyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine?
The InChIKey is UNWLHWFIWWBVEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2S/c1-5-6-14-10-13(4,11(2)3)9-12-15-7-8-16-12/h7-8,11,14H,5-6,9-10H2,1-4H3.
What are the key properties of 2,3-dimethyl-N-propyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine?
2,3-dimethyl-N-propyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine has a molecular weight of 240.42 g/mol, XLogP of 3.35, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-N-propyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine is sourced from PubChem (CID 83160211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).