C17H32N2OS — CID 83150871
2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-N-(2-methoxyethyl)-2,3-dimethylbutan-1-amine (PubChem CID 83150871) has the molecular formula C17H32N2OS and a molecular weight of 312.52 g/mol. Its IUPAC name is 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-N-(2-methoxyethyl)-2,3-dimethylbutan-1-amine.
| Compound Name | 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-N-(2-methoxyethyl)-2,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 83150871 |
| Molecular Formula | C17H32N2OS |
| Molecular Weight | 312.52 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-N-(2-methoxyethyl)-2,3-dimethylbutan-1-amine |
| SMILES | COCCNCC(C)(Cc1nc(C(C)(C)C)cs1)C(C)C |
| InChI | InChI=1S/C17H32N2OS/c1-13(2)17(6,12-18-8-9-20-7)10-15-19-14(11-21-15)16(3,4)5/h11,13,18H,8-10,12H2,1-7H3 |
| InChIKey | BXDSZUVCKAXXAX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|