C14H24BrNOS — CID 83150572
2-[(5-bromothiophen-2-yl)methyl]-N-(2-methoxyethyl)-2,3-dimethylbutan-1-amine (PubChem CID 83150572) has the molecular formula C14H24BrNOS and a molecular weight of 334.32 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)methyl]-N-(2-methoxyethyl)-2,3-dimethylbutan-1-amine.
| Compound Name | 2-[(5-bromothiophen-2-yl)methyl]-N-(2-methoxyethyl)-2,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 83150572 |
| Molecular Formula | C14H24BrNOS |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)methyl]-N-(2-methoxyethyl)-2,3-dimethylbutan-1-amine |
| SMILES | COCCNCC(C)(Cc1ccc(Br)s1)C(C)C |
| InChI | InChI=1S/C14H24BrNOS/c1-11(2)14(3,10-16-7-8-17-4)9-12-5-6-13(15)18-12/h5-6,11,16H,7-10H2,1-4H3 |
| InChIKey | DKUXUNBIXZWDFD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|