C14H24BrNOS — CID 55111296
2-[(5-bromothiophen-2-yl)methyl]-N-(2-methoxyethyl)-4-methylpentan-1-amine (PubChem CID 55111296) has the molecular formula C14H24BrNOS and a molecular weight of 334.32 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)methyl]-N-(2-methoxyethyl)-4-methylpentan-1-amine.
| Compound Name | 2-[(5-bromothiophen-2-yl)methyl]-N-(2-methoxyethyl)-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 55111296 |
| Molecular Formula | C14H24BrNOS |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)methyl]-N-(2-methoxyethyl)-4-methylpentan-1-amine |
| SMILES | COCCNCC(Cc1ccc(Br)s1)CC(C)C |
| InChI | InChI=1S/C14H24BrNOS/c1-11(2)8-12(10-16-6-7-17-3)9-13-4-5-14(15)18-13/h4-5,11-12,16H,6-10H2,1-3H3 |
| InChIKey | AAIZPLMBZPAGPL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|