C16H35NO — CID 114201279
N-(2-methoxyethyl)-2,4,6-trimethyl-2-propan-2-ylheptan-1-amine (PubChem CID 114201279) has the molecular formula C16H35NO and a molecular weight of 257.46 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2,4,6-trimethyl-2-propan-2-ylheptan-1-amine.
| Compound Name | N-(2-methoxyethyl)-2,4,6-trimethyl-2-propan-2-ylheptan-1-amine |
|---|---|
| PubChem CID | 114201279 |
| Molecular Formula | C16H35NO |
| Molecular Weight | 257.46 g/mol |
| Exact Mass | 257.27 |
| IUPAC Name | N-(2-methoxyethyl)-2,4,6-trimethyl-2-propan-2-ylheptan-1-amine |
| SMILES | COCCNCC(C)(CC(C)CC(C)C)C(C)C |
| InChI | InChI=1S/C16H35NO/c1-13(2)10-15(5)11-16(6,14(3)4)12-17-8-9-18-7/h13-15,17H,8-12H2,1-7H3 |
| InChIKey | CQYFAXXTCIRSDL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|