C17H29N — CID 81016684
4-(2,5-dimethylphenyl)-2,3-dimethyl-N-propylbutan-1-amine (PubChem CID 81016684) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)-2,3-dimethyl-N-propylbutan-1-amine.
| Compound Name | 4-(2,5-dimethylphenyl)-2,3-dimethyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 81016684 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 4-(2,5-dimethylphenyl)-2,3-dimethyl-N-propylbutan-1-amine |
| SMILES | CCCNCC(C)C(C)Cc1cc(C)ccc1C |
| InChI | InChI=1S/C17H29N/c1-6-9-18-12-16(5)15(4)11-17-10-13(2)7-8-14(17)3/h7-8,10,15-16,18H,6,9,11-12H2,1-5H3 |
| InChIKey | LLXIPIDCLKHSTI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|