C14H24N2 — CID 83928106
2-[1-(2,5-dimethylphenyl)propan-2-yl]propane-1,3-diamine (PubChem CID 83928106) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 2-[1-(2,5-dimethylphenyl)propan-2-yl]propane-1,3-diamine.
| Compound Name | 2-[1-(2,5-dimethylphenyl)propan-2-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 83928106 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 2-[1-(2,5-dimethylphenyl)propan-2-yl]propane-1,3-diamine |
| SMILES | Cc1ccc(C)c(CC(C)C(CN)CN)c1 |
| InChI | InChI=1S/C14H24N2/c1-10-4-5-11(2)13(6-10)7-12(3)14(8-15)9-16/h4-6,12,14H,7-9,15-16H2,1-3H3 |
| InChIKey | APWIYTLZNZQPMI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |