C13H18 — CID 83928161
1,4-dimethyl-2-(2-methylbut-3-enyl)benzene (PubChem CID 83928161) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is 1,4-dimethyl-2-(2-methylbut-3-enyl)benzene.
| Compound Name | 1,4-dimethyl-2-(2-methylbut-3-enyl)benzene |
|---|---|
| PubChem CID | 83928161 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 1,4-dimethyl-2-(2-methylbut-3-enyl)benzene |
| SMILES | C=CC(C)Cc1cc(C)ccc1C |
| InChI | InChI=1S/C13H18/c1-5-10(2)8-13-9-11(3)6-7-12(13)4/h5-7,9-10H,1,8H2,2-4H3 |
| InChIKey | LELYSDHJSBRPKR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|