C14H24N2 — CID 115136100
1-N-[2-(2,5-dimethylphenyl)ethyl]-2-methylpropane-1,2-diamine (PubChem CID 115136100) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-N-[2-(2,5-dimethylphenyl)ethyl]-2-methylpropane-1,2-diamine.
| Compound Name | 1-N-[2-(2,5-dimethylphenyl)ethyl]-2-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 115136100 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 1-N-[2-(2,5-dimethylphenyl)ethyl]-2-methylpropane-1,2-diamine |
| SMILES | Cc1ccc(C)c(CCNCC(C)(C)N)c1 |
| InChI | InChI=1S/C14H24N2/c1-11-5-6-12(2)13(9-11)7-8-16-10-14(3,4)15/h5-6,9,16H,7-8,10,15H2,1-4H3 |
| InChIKey | RRZNYOYSWYZTDH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|