C16H24N2 — CID 115254611
2-[[2-(2,5-dimethylphenyl)ethylamino]methyl]-3-methylbutanenitrile (PubChem CID 115254611) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-[[2-(2,5-dimethylphenyl)ethylamino]methyl]-3-methylbutanenitrile.
| Compound Name | 2-[[2-(2,5-dimethylphenyl)ethylamino]methyl]-3-methylbutanenitrile |
|---|---|
| PubChem CID | 115254611 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 2-[[2-(2,5-dimethylphenyl)ethylamino]methyl]-3-methylbutanenitrile |
| SMILES | Cc1ccc(C)c(CCNCC(C#N)C(C)C)c1 |
| InChI | InChI=1S/C16H24N2/c1-12(2)16(10-17)11-18-8-7-15-9-13(3)5-6-14(15)4/h5-6,9,12,16,18H,7-8,11H2,1-4H3 |
| InChIKey | UABWGLVGKNLDRX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|