C14H21N — CID 62538182
N-(cyclopropylmethyl)-2-(2,5-dimethylphenyl)ethanamine (PubChem CID 62538182) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-(2,5-dimethylphenyl)ethanamine.
| Compound Name | N-(cyclopropylmethyl)-2-(2,5-dimethylphenyl)ethanamine |
|---|---|
| PubChem CID | 62538182 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | N-(cyclopropylmethyl)-2-(2,5-dimethylphenyl)ethanamine |
| SMILES | Cc1ccc(C)c(CCNCC2CC2)c1 |
| InChI | InChI=1S/C14H21N/c1-11-3-4-12(2)14(9-11)7-8-15-10-13-5-6-13/h3-4,9,13,15H,5-8,10H2,1-2H3 |
| InChIKey | BKRMCHOXWJLBTK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|