C16H24 — CID 59184196
2-(2-cyclohexylethyl)-1,4-dimethylbenzene (PubChem CID 59184196) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 2-(2-cyclohexylethyl)-1,4-dimethylbenzene.
| Compound Name | 2-(2-cyclohexylethyl)-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 59184196 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 2-(2-cyclohexylethyl)-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(CCC2CCCCC2)c1 |
| InChI | InChI=1S/C16H24/c1-13-8-9-14(2)16(12-13)11-10-15-6-4-3-5-7-15/h8-9,12,15H,3-7,10-11H2,1-2H3 |
| InChIKey | LAKUNEUBYJCSLL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |