C31H44F2 — CID 145488932
2-(2-cyclohexylethyl)-4-fluoro-1-methylbenzene;2-(2-cyclopentylethyl)-4-fluoro-1-methylbenzene;ethene (PubChem CID 145488932) has the molecular formula C31H44F2 and a molecular weight of 454.69 g/mol. Its IUPAC name is 2-(2-cyclohexylethyl)-4-fluoro-1-methylbenzene;2-(2-cyclopentylethyl)-4-fluoro-1-methylbenzene;ethene.
| Compound Name | 2-(2-cyclohexylethyl)-4-fluoro-1-methylbenzene;2-(2-cyclopentylethyl)-4-fluoro-1-methylbenzene;ethene |
|---|---|
| PubChem CID | 145488932 |
| Molecular Formula | C31H44F2 |
| Molecular Weight | 454.69 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | 2-(2-cyclohexylethyl)-4-fluoro-1-methylbenzene;2-(2-cyclopentylethyl)-4-fluoro-1-methylbenzene;ethene |
| SMILES | C=C.Cc1ccc(F)cc1CCC1CCCC1.Cc1ccc(F)cc1CCC1CCCCC1 |
| InChI | InChI=1S/C15H21F.C14H19F.C2H4/c1-12-7-10-15(16)11-14(12)9-8-13-5-3-2-4-6-13;1-11-6-9-14(15)10-13(11)8-7-12-4-2-3-5-12;1-2/h7,10-11,13H,2-6,8-9H2,1H3;6,9-10,12H,2-5,7-8H2,1H3;1-2H2 |
| InChIKey | SVVBQXORBUDBEV-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.69 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|