C13H18O — CID 83928166
2-[2-(2,5-dimethylphenyl)ethyl]-3-methyloxirane (PubChem CID 83928166) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 2-[2-(2,5-dimethylphenyl)ethyl]-3-methyloxirane.
| Compound Name | 2-[2-(2,5-dimethylphenyl)ethyl]-3-methyloxirane |
|---|---|
| PubChem CID | 83928166 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 2-[2-(2,5-dimethylphenyl)ethyl]-3-methyloxirane |
| SMILES | Cc1ccc(C)c(CCC2OC2C)c1 |
| InChI | InChI=1S/C13H18O/c1-9-4-5-10(2)12(8-9)6-7-13-11(3)14-13/h4-5,8,11,13H,6-7H2,1-3H3 |
| InChIKey | AXHLOQXMWDXPNO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|