C11H14O — CID 14045723
2-[(2,5-dimethylphenyl)methyl]oxirane (PubChem CID 14045723) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)methyl]oxirane.
| Compound Name | 2-[(2,5-dimethylphenyl)methyl]oxirane |
|---|---|
| PubChem CID | 14045723 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 2-[(2,5-dimethylphenyl)methyl]oxirane |
| SMILES | Cc1ccc(C)c(CC2CO2)c1 |
| InChI | InChI=1S/C11H14O/c1-8-3-4-9(2)10(5-8)6-11-7-12-11/h3-5,11H,6-7H2,1-2H3 |
| InChIKey | NYHJWNUIJCKWES-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|