About 2-[(2,4-difluoro-5-methylphenyl)methyl]oxirane
2-[(2,4-difluoro-5-methylphenyl)methyl]oxirane (PubChem CID 131145982) has the molecular formula C10H10F2O
and a molecular weight of 184.18 g/mol. Its IUPAC name is 2-[(2,4-difluoro-5-methylphenyl)methyl]oxirane.
Molecular Properties
| Compound Name | 2-[(2,4-difluoro-5-methylphenyl)methyl]oxirane |
| PubChem CID | 131145982 |
| Molecular Formula | C10H10F2O |
| Molecular Weight | 184.18 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 2-[(2,4-difluoro-5-methylphenyl)methyl]oxirane |
| SMILES | Cc1cc(CC2CO2)c(F)cc1F |
| InChI | InChI=1S/C10H10F2O/c1-6-2-7(3-8-5-13-8)10(12)4-9(6)11/h2,4,8H,3,5H2,1H3 |
| InChIKey | WOBQUYAASKGVKR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.18 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,4-difluoro-5-methylphenyl)methyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4-difluoro-5-methylphenyl)methyl]oxirane?
The IUPAC name of 2-[(2,4-difluoro-5-methylphenyl)methyl]oxirane (CID 131145982) is 2-[(2,4-difluoro-5-methylphenyl)methyl]oxirane.
What is the SMILES notation for 2-[(2,4-difluoro-5-methylphenyl)methyl]oxirane?
The canonical SMILES for 2-[(2,4-difluoro-5-methylphenyl)methyl]oxirane is Cc1cc(CC2CO2)c(F)cc1F.
What is the InChIKey of 2-[(2,4-difluoro-5-methylphenyl)methyl]oxirane?
The InChIKey is WOBQUYAASKGVKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F2O/c1-6-2-7(3-8-5-13-8)10(12)4-9(6)11/h2,4,8H,3,5H2,1H3.
What are the key properties of 2-[(2,4-difluoro-5-methylphenyl)methyl]oxirane?
2-[(2,4-difluoro-5-methylphenyl)methyl]oxirane has a molecular weight of 184.18 g/mol, XLogP of 2.21, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-difluoro-5-methylphenyl)methyl]oxirane is sourced from PubChem (CID 131145982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).