C12H9F7O — CID 71345448
2-[[4-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]oxirane (PubChem CID 71345448) has the molecular formula C12H9F7O and a molecular weight of 302.19 g/mol. Its IUPAC name is 2-[[4-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]oxirane.
| Compound Name | 2-[[4-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]oxirane |
|---|---|
| PubChem CID | 71345448 |
| Molecular Formula | C12H9F7O |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-[[4-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]oxirane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)c1ccc(CC2CO2)cc1 |
| InChI | InChI=1S/C12H9F7O/c13-10(14,11(15,16)12(17,18)19)8-3-1-7(2-4-8)5-9-6-20-9/h1-4,9H,5-6H2 |
| InChIKey | CEXDSECOBNBQNX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|