C13H20N2 — CID 82282920
2-[(2,5-dimethylphenyl)methyl]piperazine (PubChem CID 82282920) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)methyl]piperazine.
| Compound Name | 2-[(2,5-dimethylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 82282920 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 2-[(2,5-dimethylphenyl)methyl]piperazine |
| SMILES | Cc1ccc(C)c(CC2CNCCN2)c1 |
| InChI | InChI=1S/C13H20N2/c1-10-3-4-11(2)12(7-10)8-13-9-14-5-6-15-13/h3-4,7,13-15H,5-6,8-9H2,1-2H3 |
| InChIKey | GOHSYZYUMGSAJN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |